C19H28ClNO3 — CID 22161810
3-cyclohexyl-1-[(prop-2-enylamino)methyl]-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride (PubChem CID 22161810) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(prop-2-enylamino)methyl]-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride.
| Compound Name | 3-cyclohexyl-1-[(prop-2-enylamino)methyl]-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride |
|---|---|
| PubChem CID | 22161810 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-cyclohexyl-1-[(prop-2-enylamino)methyl]-3,4-dihydro-1H-isochromene-5,6-diol;hydrochloride |
| SMILES | C=CCNCC1OC(C2CCCCC2)Cc2c1ccc(O)c2O.Cl |
| InChI | InChI=1S/C19H27NO3.ClH/c1-2-10-20-12-18-14-8-9-16(21)19(22)15(14)11-17(23-18)13-6-4-3-5-7-13;/h2,8-9,13,17-18,20-22H,1,3-7,10-12H2;1H |
| InChIKey | LEMUCESBAHJHMV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|