C21H27NO4 — CID 22161816
1-(aminomethyl)-3-[(4-tert-butylphenoxy)methyl]-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 22161816) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-(aminomethyl)-3-[(4-tert-butylphenoxy)methyl]-3,4-dihydro-1H-isochromene-5,6-diol.
| Compound Name | 1-(aminomethyl)-3-[(4-tert-butylphenoxy)methyl]-3,4-dihydro-1H-isochromene-5,6-diol |
|---|---|
| PubChem CID | 22161816 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-(aminomethyl)-3-[(4-tert-butylphenoxy)methyl]-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CC(C)(C)c1ccc(OCC2Cc3c(ccc(O)c3O)C(CN)O2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-21(2,3)13-4-6-14(7-5-13)25-12-15-10-17-16(19(11-22)26-15)8-9-18(23)20(17)24/h4-9,15,19,23-24H,10-12,22H2,1-3H3 |
| InChIKey | KUPWMGMRLHCYJQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|