About 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene
5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene (PubChem CID 22161976) has the molecular formula C9H14O4S
and a molecular weight of 218.27 g/mol. Its IUPAC name is 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene |
| PubChem CID | 22161976 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene |
| SMILES | COC1C=CC=CC1(OC)S(C)(=O)=O |
| InChI | InChI=1S/C9H14O4S/c1-12-8-6-4-5-7-9(8,13-2)14(3,10)11/h4-8H,1-3H3 |
| InChIKey | QMJQYJJIDZEQFW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene?
The IUPAC name of 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene (CID 22161976) is 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene.
What is the SMILES notation for 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene?
The canonical SMILES for 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene is COC1C=CC=CC1(OC)S(C)(=O)=O.
What is the InChIKey of 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene?
The InChIKey is QMJQYJJIDZEQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S/c1-12-8-6-4-5-7-9(8,13-2)14(3,10)11/h4-8H,1-3H3.
What are the key properties of 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene?
5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene has a molecular weight of 218.27 g/mol, XLogP of 0.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-5-methylsulfonylcyclohexa-1,3-diene is sourced from PubChem (CID 22161976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).