About 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile
7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile (PubChem CID 22162187) has the molecular formula C16H11N5O
and a molecular weight of 289.30 g/mol. Its IUPAC name is 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile.
Molecular Properties
| Compound Name | 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile |
| PubChem CID | 22162187 |
| Molecular Formula | C16H11N5O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile |
| SMILES | CC1(C#N)C(=O)Nc2cc3nc(-c4cccnc4)[nH]c3cc21 |
| InChI | InChI=1S/C16H11N5O/c1-16(8-17)10-5-12-13(6-11(10)21-15(16)22)20-14(19-12)9-3-2-4-18-7-9/h2-7H,1H3,(H,19,20)(H,21,22) |
| InChIKey | QDLQPDFTNQHWIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile?
The IUPAC name of 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile (CID 22162187) is 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile.
What is the SMILES notation for 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile?
The canonical SMILES for 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile is CC1(C#N)C(=O)Nc2cc3nc(-c4cccnc4)[nH]c3cc21.
What is the InChIKey of 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile?
The InChIKey is QDLQPDFTNQHWIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N5O/c1-16(8-17)10-5-12-13(6-11(10)21-15(16)22)20-14(19-12)9-3-2-4-18-7-9/h2-7H,1H3,(H,19,20)(H,21,22).
What are the key properties of 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile?
7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile has a molecular weight of 289.30 g/mol, XLogP of 2.36, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6-oxo-2-pyridin-3-yl-1,5-dihydropyrrolo[2,3-f]benzimidazole-7-carbonitrile is sourced from PubChem (CID 22162187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).