About benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid
benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 22162631) has the molecular formula C16H21N4O8+
and a molecular weight of 397.36 g/mol. Its IUPAC name is benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid.
Molecular Properties
| Compound Name | benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| PubChem CID | 22162631 |
| Molecular Formula | C16H21N4O8+ |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | N#[N+]c1ccccc1.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C6H5N2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;7-8-6-4-2-1-3-5-6/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-5H/q;+1 |
| InChIKey | FAHYZRGEOMUPEI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid?
The IUPAC name of benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid (CID 22162631) is benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid.
What is the SMILES notation for benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid?
The canonical SMILES for benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid is N#[N+]c1ccccc1.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.
What is the InChIKey of benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid?
The InChIKey is FAHYZRGEOMUPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O8.C6H5N2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;7-8-6-4-2-1-3-5-6/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-5H/q;+1.
What are the key properties of benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid?
benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid has a molecular weight of 397.36 g/mol, XLogP of 0.10, 11 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzenediazonium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid is sourced from PubChem (CID 22162631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).