About trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane
trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane (PubChem CID 22162782) has the molecular formula C10H12F4Si
and a molecular weight of 236.28 g/mol. Its IUPAC name is trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane.
Molecular Properties
| Compound Name | trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane |
| PubChem CID | 22162782 |
| Molecular Formula | C10H12F4Si |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane |
| SMILES | Cc1c(F)c(F)c([Si](C)(C)C)c(F)c1F |
| InChI | InChI=1S/C10H12F4Si/c1-5-6(11)8(13)10(15(2,3)4)9(14)7(5)12/h1-4H3 |
| InChIKey | XCLXIDYODXFUCP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane?
The IUPAC name of trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane (CID 22162782) is trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane.
What is the SMILES notation for trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane?
The canonical SMILES for trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane is Cc1c(F)c(F)c([Si](C)(C)C)c(F)c1F.
What is the InChIKey of trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane?
The InChIKey is XCLXIDYODXFUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F4Si/c1-5-6(11)8(13)10(15(2,3)4)9(14)7(5)12/h1-4H3.
What are the key properties of trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane?
trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane has a molecular weight of 236.28 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2,3,5,6-tetrafluoro-4-methylphenyl)silane is sourced from PubChem (CID 22162782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).