About 1,1,3-triethoxybutane
1,1,3-triethoxybutane (PubChem CID 22163) has the molecular formula C10H22O3
and a molecular weight of 190.28 g/mol. Its IUPAC name is 1,1,3-triethoxybutane.
Molecular Properties
| Compound Name | 1,1,3-triethoxybutane |
| PubChem CID | 22163 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 1,1,3-triethoxybutane |
| SMILES | CCOC(C)CC(OCC)OCC |
| InChI | InChI=1S/C10H22O3/c1-5-11-9(4)8-10(12-6-2)13-7-3/h9-10H,5-8H2,1-4H3 |
| InChIKey | MDIBXLWYZGZAKL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-triethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-triethoxybutane?
The IUPAC name of 1,1,3-triethoxybutane (CID 22163) is 1,1,3-triethoxybutane.
What is the SMILES notation for 1,1,3-triethoxybutane?
The canonical SMILES for 1,1,3-triethoxybutane is CCOC(C)CC(OCC)OCC.
What is the InChIKey of 1,1,3-triethoxybutane?
The InChIKey is MDIBXLWYZGZAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3/c1-5-11-9(4)8-10(12-6-2)13-7-3/h9-10H,5-8H2,1-4H3.
What are the key properties of 1,1,3-triethoxybutane?
1,1,3-triethoxybutane has a molecular weight of 190.28 g/mol, XLogP of 2.20, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-triethoxybutane is sourced from PubChem (CID 22163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).