C8H11F3N2O3S2 — CID 22163061
5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol;trifluoromethanesulfonic acid (PubChem CID 22163061) has the molecular formula C8H11F3N2O3S2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol;trifluoromethanesulfonic acid.
| Compound Name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 22163061 |
| Molecular Formula | C8H11F3N2O3S2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-thiol;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.SC1CCn2ccnc2C1 |
| InChI | InChI=1S/C7H10N2S.CHF3O3S/c10-6-1-3-9-4-2-8-7(9)5-6;2-1(3,4)8(5,6)7/h2,4,6,10H,1,3,5H2;(H,5,6,7) |
| InChIKey | SHVCAXJJQJFZTD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|