About 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate
2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate (PubChem CID 22163461) has the molecular formula C10H9N2O4-
and a molecular weight of 221.19 g/mol. Its IUPAC name is 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate.
Molecular Properties
| Compound Name | 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate |
| PubChem CID | 22163461 |
| Molecular Formula | C10H9N2O4- |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate |
| SMILES | CC(Oc1cccc2onc(N)c12)C(=O)[O-] |
| InChI | InChI=1S/C10H10N2O4/c1-5(10(13)14)15-6-3-2-4-7-8(6)9(11)12-16-7/h2-5H,1H3,(H2,11,12)(H,13,14)/p-1 |
| InChIKey | UCQQYURGASEJQJ-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate?
The IUPAC name of 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate (CID 22163461) is 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate.
What is the SMILES notation for 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate?
The canonical SMILES for 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate is CC(Oc1cccc2onc(N)c12)C(=O)[O-].
What is the InChIKey of 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate?
The InChIKey is UCQQYURGASEJQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10N2O4/c1-5(10(13)14)15-6-3-2-4-7-8(6)9(11)12-16-7/h2-5H,1H3,(H2,11,12)(H,13,14)/p-1.
What are the key properties of 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate?
2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate has a molecular weight of 221.19 g/mol, XLogP of -0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-1,2-benzoxazol-4-yl)oxy]propanoate is sourced from PubChem (CID 22163461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).