About butyl 2-isocyanatohexanoate
butyl 2-isocyanatohexanoate (PubChem CID 22163519) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is butyl 2-isocyanatohexanoate.
Molecular Properties
| Compound Name | butyl 2-isocyanatohexanoate |
| PubChem CID | 22163519 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | butyl 2-isocyanatohexanoate |
| SMILES | CCCCOC(=O)C(CCCC)N=C=O |
| InChI | InChI=1S/C11H19NO3/c1-3-5-7-10(12-9-13)11(14)15-8-6-4-2/h10H,3-8H2,1-2H3 |
| InChIKey | ZDSNDCWWKLIYJH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-isocyanatohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-isocyanatohexanoate?
The IUPAC name of butyl 2-isocyanatohexanoate (CID 22163519) is butyl 2-isocyanatohexanoate.
What is the SMILES notation for butyl 2-isocyanatohexanoate?
The canonical SMILES for butyl 2-isocyanatohexanoate is CCCCOC(=O)C(CCCC)N=C=O.
What is the InChIKey of butyl 2-isocyanatohexanoate?
The InChIKey is ZDSNDCWWKLIYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-3-5-7-10(12-9-13)11(14)15-8-6-4-2/h10H,3-8H2,1-2H3.
What are the key properties of butyl 2-isocyanatohexanoate?
butyl 2-isocyanatohexanoate has a molecular weight of 213.28 g/mol, XLogP of 2.22, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-isocyanatohexanoate is sourced from PubChem (CID 22163519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).