C25H30Cl2N4S — CID 22163663
4-decyl-7-(3,4-dichlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 22163663) has the molecular formula C25H30Cl2N4S and a molecular weight of 489.52 g/mol. Its IUPAC name is 4-decyl-7-(3,4-dichlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 4-decyl-7-(3,4-dichlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 22163663 |
| Molecular Formula | C25H30Cl2N4S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-decyl-7-(3,4-dichlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CCCCCCCCCCc1cc2c(s1)-n1c(C)nnc1CN=C2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H30Cl2N4S/c1-3-4-5-6-7-8-9-10-11-19-15-20-24(18-12-13-21(26)22(27)14-18)28-16-23-30-29-17(2)31(23)25(20)32-19/h12-15H,3-11,16H2,1-2H3 |
| InChIKey | ZYJWMCGCOVAMIV-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|