About 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one
2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one (PubChem CID 22163846) has the molecular formula C22H20ClN3O3
and a molecular weight of 409.87 g/mol. Its IUPAC name is 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one |
| PubChem CID | 22163846 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one |
| SMILES | CC(C)OCC(=O)CC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-13(2)29-12-15(27)11-18-16-5-3-4-6-17(16)22(28)26(18)20-10-8-14-7-9-19(23)24-21(14)25-20/h3-10,13,18H,11-12H2,1-2H3 |
| InChIKey | OXOKYHTVMWYZJW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one?
The IUPAC name of 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one (CID 22163846) is 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one.
What is the SMILES notation for 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one?
The canonical SMILES for 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one is CC(C)OCC(=O)CC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1.
What is the InChIKey of 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one?
The InChIKey is OXOKYHTVMWYZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClN3O3/c1-13(2)29-12-15(27)11-18-16-5-3-4-6-17(16)22(28)26(18)20-10-8-14-7-9-19(23)24-21(14)25-20/h3-10,13,18H,11-12H2,1-2H3.
What are the key properties of 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one?
2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one has a molecular weight of 409.87 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-chloro-1,8-naphthyridin-2-yl)-3-(2-oxo-3-propan-2-yloxypropyl)-3H-isoindol-1-one is sourced from PubChem (CID 22163846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).