C17H12Br2N4O — CID 22163885
1,3-bis(3H-benzimidazol-5-yl)-1,3-dibromopropan-2-one (PubChem CID 22163885) has the molecular formula C17H12Br2N4O and a molecular weight of 448.12 g/mol. Its IUPAC name is 1,3-bis(3H-benzimidazol-5-yl)-1,3-dibromopropan-2-one.
| Compound Name | 1,3-bis(3H-benzimidazol-5-yl)-1,3-dibromopropan-2-one |
|---|---|
| PubChem CID | 22163885 |
| Molecular Formula | C17H12Br2N4O |
| Molecular Weight | 448.12 g/mol |
| Exact Mass | 445.94 |
| IUPAC Name | 1,3-bis(3H-benzimidazol-5-yl)-1,3-dibromopropan-2-one |
| SMILES | O=C(C(Br)c1ccc2nc[nH]c2c1)C(Br)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C17H12Br2N4O/c18-15(9-1-3-11-13(5-9)22-7-20-11)17(24)16(19)10-2-4-12-14(6-10)23-8-21-12/h1-8,15-16H,(H,20,22)(H,21,23) |
| InChIKey | MIHCDCCHGGKGIC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.12 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|