About 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide
4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide (PubChem CID 22163927) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide |
| PubChem CID | 22163927 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide |
| SMILES | Cc1cc(C=O)c(C)n1-c1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-9-14(10-19)12(2)18(11)15-7-5-13(6-8-15)16(20)17(3)4/h5-10H,1-4H3 |
| InChIKey | QPWNOONOWPNOFS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide?
The IUPAC name of 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide (CID 22163927) is 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide.
What is the SMILES notation for 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide?
The canonical SMILES for 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide is Cc1cc(C=O)c(C)n1-c1ccc(C(=O)N(C)C)cc1.
What is the InChIKey of 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide?
The InChIKey is QPWNOONOWPNOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-11-9-14(10-19)12(2)18(11)15-7-5-13(6-8-15)16(20)17(3)4/h5-10H,1-4H3.
What are the key properties of 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide?
4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide has a molecular weight of 270.33 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-formyl-2,5-dimethylpyrrol-1-yl)-N,N-dimethylbenzamide is sourced from PubChem (CID 22163927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).