About 3-aminocyclohexa-1,3-dien-1-ol
3-aminocyclohexa-1,3-dien-1-ol (PubChem CID 22164043) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 3-aminocyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 3-aminocyclohexa-1,3-dien-1-ol |
| PubChem CID | 22164043 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 3-aminocyclohexa-1,3-dien-1-ol |
| SMILES | NC1=CCCC(O)=C1 |
| InChI | InChI=1S/C6H9NO/c7-5-2-1-3-6(8)4-5/h2,4,8H,1,3,7H2 |
| InChIKey | RPJKLVZIZBYUBN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-aminocyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminocyclohexa-1,3-dien-1-ol?
The IUPAC name of 3-aminocyclohexa-1,3-dien-1-ol (CID 22164043) is 3-aminocyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 3-aminocyclohexa-1,3-dien-1-ol?
The canonical SMILES for 3-aminocyclohexa-1,3-dien-1-ol is NC1=CCCC(O)=C1.
What is the InChIKey of 3-aminocyclohexa-1,3-dien-1-ol?
The InChIKey is RPJKLVZIZBYUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c7-5-2-1-3-6(8)4-5/h2,4,8H,1,3,7H2.
What are the key properties of 3-aminocyclohexa-1,3-dien-1-ol?
3-aminocyclohexa-1,3-dien-1-ol has a molecular weight of 111.14 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminocyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 22164043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).