About 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one
6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 22164056) has the molecular formula C8H6ClNO3S
and a molecular weight of 231.66 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| PubChem CID | 22164056 |
| Molecular Formula | C8H6ClNO3S |
| Molecular Weight | 231.66 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | O=C1CS(=O)(=O)c2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C8H6ClNO3S/c9-5-1-2-7-6(3-5)10-8(11)4-14(7,12)13/h1-3H,4H2,(H,10,11) |
| InChIKey | NNZKZKIRGUGJIH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.66 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The IUPAC name of 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (CID 22164056) is 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
What is the SMILES notation for 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The canonical SMILES for 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is O=C1CS(=O)(=O)c2ccc(Cl)cc2N1.
What is the InChIKey of 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The InChIKey is NNZKZKIRGUGJIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO3S/c9-5-1-2-7-6(3-5)10-8(11)4-14(7,12)13/h1-3H,4H2,(H,10,11).
What are the key properties of 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one has a molecular weight of 231.66 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is sourced from PubChem (CID 22164056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).