C20H27N3O3 — CID 22164219
N,N-dimethyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxamide (PubChem CID 22164219) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N,N-dimethyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxamide.
| Compound Name | N,N-dimethyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxamide |
|---|---|
| PubChem CID | 22164219 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N,N-dimethyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxamide |
| SMILES | CN(C)C(=O)N1CCCC2CN3CCc4cc5c(cc4C3CC21)OCO5 |
| InChI | InChI=1S/C20H27N3O3/c1-21(2)20(24)23-6-3-4-14-11-22-7-5-13-8-18-19(26-12-25-18)9-15(13)17(22)10-16(14)23/h8-9,14,16-17H,3-7,10-12H2,1-2H3 |
| InChIKey | MLVQJZGFGPCBLJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |