About 2H-oxazine;phenazine
2H-oxazine;phenazine (PubChem CID 22164631) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is 2H-oxazine;phenazine.
Molecular Properties
| Compound Name | 2H-oxazine;phenazine |
| PubChem CID | 22164631 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2H-oxazine;phenazine |
| SMILES | C1=CNOC=C1.c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2.C4H5NO/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-4-6-5-3-1/h1-8H;1-5H |
| InChIKey | ZFIVVECWNCQIRA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2H-oxazine;phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-oxazine;phenazine?
The IUPAC name of 2H-oxazine;phenazine (CID 22164631) is 2H-oxazine;phenazine.
What is the SMILES notation for 2H-oxazine;phenazine?
The canonical SMILES for 2H-oxazine;phenazine is C1=CNOC=C1.c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of 2H-oxazine;phenazine?
The InChIKey is ZFIVVECWNCQIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C4H5NO/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;1-2-4-6-5-3-1/h1-8H;1-5H.
What are the key properties of 2H-oxazine;phenazine?
2H-oxazine;phenazine has a molecular weight of 263.30 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-oxazine;phenazine is sourced from PubChem (CID 22164631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).