C19H20O3S — CID 22164634
4,8,12-trimethylpentacyclo[8.5.1.03,6.07,16.011,14]hexadeca-1(16),2,6,10,14-pentaene-2-sulfonic acid (PubChem CID 22164634) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 4,8,12-trimethylpentacyclo[8.5.1.03,6.07,16.011,14]hexadeca-1(16),2,6,10,14-pentaene-2-sulfonic acid.
| Compound Name | 4,8,12-trimethylpentacyclo[8.5.1.03,6.07,16.011,14]hexadeca-1(16),2,6,10,14-pentaene-2-sulfonic acid |
|---|---|
| PubChem CID | 22164634 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4,8,12-trimethylpentacyclo[8.5.1.03,6.07,16.011,14]hexadeca-1(16),2,6,10,14-pentaene-2-sulfonic acid |
| SMILES | CC1Cc2c1c(S(=O)(=O)O)c1cc3c(c4c1c2C(C)C4)C(C)C3 |
| InChI | InChI=1S/C19H20O3S/c1-8-4-11-7-14-18-12(15(8)11)5-9(2)16(18)13-6-10(3)17(13)19(14)23(20,21)22/h7-10H,4-6H2,1-3H3,(H,20,21,22) |
| InChIKey | AUSAQBIWBLKQEF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|