C30H60O6Si6 — CID 22165120
trimethyl-[[2,3,4,5,6-pentakis(trimethylsilyloxymethylidene)cyclohexylidene]methoxy]silane (PubChem CID 22165120) has the molecular formula C30H60O6Si6 and a molecular weight of 685.32 g/mol. Its IUPAC name is trimethyl-[[2,3,4,5,6-pentakis(trimethylsilyloxymethylidene)cyclohexylidene]methoxy]silane.
| Compound Name | trimethyl-[[2,3,4,5,6-pentakis(trimethylsilyloxymethylidene)cyclohexylidene]methoxy]silane |
|---|---|
| PubChem CID | 22165120 |
| Molecular Formula | C30H60O6Si6 |
| Molecular Weight | 685.32 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | trimethyl-[[2,3,4,5,6-pentakis(trimethylsilyloxymethylidene)cyclohexylidene]methoxy]silane |
| SMILES | C[Si](C)(C)OC=c1c(=CO[Si](C)(C)C)c(=CO[Si](C)(C)C)c(=CO[Si](C)(C)C)c(=CO[Si](C)(C)C)c1=CO[Si](C)(C)C |
| InChI | InChI=1S/C30H60O6Si6/c1-37(2,3)31-19-25-26(20-32-38(4,5)6)28(22-34-40(10,11)12)30(24-36-42(16,17)18)29(23-35-41(13,14)15)27(25)21-33-39(7,8)9/h19-24H,1-18H3/b25-19-,26-20+,27-21-,28-22+,29-23-,30-24+ |
| InChIKey | CIUHZDANUWKXES-NAYFRYFHSA-N |
| XLogP | 5.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|