About 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride
3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride (PubChem CID 22165654) has the molecular formula C15H12ClN3O
and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride |
| PubChem CID | 22165654 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride |
| SMILES | Cl.c1ccc2cc3c(Cn4ccnc4)noc3cc2c1 |
| InChI | InChI=1S/C15H11N3O.ClH/c1-2-4-12-8-15-13(7-11(12)3-1)14(17-19-15)9-18-6-5-16-10-18;/h1-8,10H,9H2;1H |
| InChIKey | BGFISKOIGTXCHI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride?
The IUPAC name of 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride (CID 22165654) is 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride.
What is the SMILES notation for 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride?
The canonical SMILES for 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride is Cl.c1ccc2cc3c(Cn4ccnc4)noc3cc2c1.
What is the InChIKey of 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride?
The InChIKey is BGFISKOIGTXCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O.ClH/c1-2-4-12-8-15-13(7-11(12)3-1)14(17-19-15)9-18-6-5-16-10-18;/h1-8,10H,9H2;1H.
What are the key properties of 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride?
3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride has a molecular weight of 285.73 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(imidazol-1-ylmethyl)benzo[f][1,2]benzoxazole;hydrochloride is sourced from PubChem (CID 22165654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).