C11H22O8P2 — CID 22165779
3,9-bis(2-methoxyethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 22165779) has the molecular formula C11H22O8P2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 3,9-bis(2-methoxyethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis(2-methoxyethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22165779 |
| Molecular Formula | C11H22O8P2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3,9-bis(2-methoxyethoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | COCCOP1OCC2(CO1)COP(OCCOC)OC2 |
| InChI | InChI=1S/C11H22O8P2/c1-12-3-5-14-20-16-7-11(8-17-20)9-18-21(19-10-11)15-6-4-13-2/h3-10H2,1-2H3 |
| InChIKey | NSWMLDMVQMFFMP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|