About 1-ethyl-4-methyl-1,4-diazepane
1-ethyl-4-methyl-1,4-diazepane (PubChem CID 22165959) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-ethyl-4-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-ethyl-4-methyl-1,4-diazepane |
| PubChem CID | 22165959 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-ethyl-4-methyl-1,4-diazepane |
| SMILES | CCN1CCCN(C)CC1 |
| InChI | InChI=1S/C8H18N2/c1-3-10-6-4-5-9(2)7-8-10/h3-8H2,1-2H3 |
| InChIKey | IMJVLUBQARFYHA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methyl-1,4-diazepane?
The IUPAC name of 1-ethyl-4-methyl-1,4-diazepane (CID 22165959) is 1-ethyl-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-ethyl-4-methyl-1,4-diazepane?
The canonical SMILES for 1-ethyl-4-methyl-1,4-diazepane is CCN1CCCN(C)CC1.
What is the InChIKey of 1-ethyl-4-methyl-1,4-diazepane?
The InChIKey is IMJVLUBQARFYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-3-10-6-4-5-9(2)7-8-10/h3-8H2,1-2H3.
What are the key properties of 1-ethyl-4-methyl-1,4-diazepane?
1-ethyl-4-methyl-1,4-diazepane has a molecular weight of 142.25 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methyl-1,4-diazepane is sourced from PubChem (CID 22165959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).