About 2-propan-2-yloxyethyl carbonochloridate
2-propan-2-yloxyethyl carbonochloridate (PubChem CID 22165961) has the molecular formula C6H11ClO3
and a molecular weight of 166.60 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl carbonochloridate.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethyl carbonochloridate |
| PubChem CID | 22165961 |
| Molecular Formula | C6H11ClO3 |
| Molecular Weight | 166.60 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 2-propan-2-yloxyethyl carbonochloridate |
| SMILES | CC(C)OCCOC(=O)Cl |
| InChI | InChI=1S/C6H11ClO3/c1-5(2)9-3-4-10-6(7)8/h5H,3-4H2,1-2H3 |
| InChIKey | CANSGGIJUBZCMT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethyl carbonochloridate?
The IUPAC name of 2-propan-2-yloxyethyl carbonochloridate (CID 22165961) is 2-propan-2-yloxyethyl carbonochloridate.
What is the SMILES notation for 2-propan-2-yloxyethyl carbonochloridate?
The canonical SMILES for 2-propan-2-yloxyethyl carbonochloridate is CC(C)OCCOC(=O)Cl.
What is the InChIKey of 2-propan-2-yloxyethyl carbonochloridate?
The InChIKey is CANSGGIJUBZCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClO3/c1-5(2)9-3-4-10-6(7)8/h5H,3-4H2,1-2H3.
What are the key properties of 2-propan-2-yloxyethyl carbonochloridate?
2-propan-2-yloxyethyl carbonochloridate has a molecular weight of 166.60 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl carbonochloridate is sourced from PubChem (CID 22165961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).