C12H17NO3 — CID 2216614
methyl N-[2-(2,5-dimethylphenoxy)ethyl]carbamate (PubChem CID 2216614) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl N-[2-(2,5-dimethylphenoxy)ethyl]carbamate.
| Compound Name | methyl N-[2-(2,5-dimethylphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 2216614 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl N-[2-(2,5-dimethylphenoxy)ethyl]carbamate |
| SMILES | COC(=O)NCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C12H17NO3/c1-9-4-5-10(2)11(8-9)16-7-6-13-12(14)15-3/h4-5,8H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | UBAIBRRHCAYDKU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|