C18H24N2O3S — CID 22166379
5-[7-[2-(4,5-dihydro-1,3-oxazol-2-yl)thiophen-3-yl]oxyheptyl]-3-methyl-1,2-oxazole (PubChem CID 22166379) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-[7-[2-(4,5-dihydro-1,3-oxazol-2-yl)thiophen-3-yl]oxyheptyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[7-[2-(4,5-dihydro-1,3-oxazol-2-yl)thiophen-3-yl]oxyheptyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 22166379 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 5-[7-[2-(4,5-dihydro-1,3-oxazol-2-yl)thiophen-3-yl]oxyheptyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCCCCCOc2ccsc2C2=NCCO2)on1 |
| InChI | InChI=1S/C18H24N2O3S/c1-14-13-15(23-20-14)7-5-3-2-4-6-10-21-16-8-12-24-17(16)18-19-9-11-22-18/h8,12-13H,2-7,9-11H2,1H3 |
| InChIKey | HBCUPIVYHPXZJL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|