About 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole
2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole (PubChem CID 22166947) has the molecular formula C12H12N4OS3
and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole.
Molecular Properties
| Compound Name | 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole |
| PubChem CID | 22166947 |
| Molecular Formula | C12H12N4OS3 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole |
| SMILES | CSc1nc(CS(=O)c2nc3cscc3[nH]2)ncc1C |
| InChI | InChI=1S/C12H12N4OS3/c1-7-3-13-10(16-11(7)18-2)6-20(17)12-14-8-4-19-5-9(8)15-12/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | DRLNJNKUVPOYKZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole?
The IUPAC name of 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole (CID 22166947) is 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole.
What is the SMILES notation for 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole?
The canonical SMILES for 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole is CSc1nc(CS(=O)c2nc3cscc3[nH]2)ncc1C.
What is the InChIKey of 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole?
The InChIKey is DRLNJNKUVPOYKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4OS3/c1-7-3-13-10(16-11(7)18-2)6-20(17)12-14-8-4-19-5-9(8)15-12/h3-5H,6H2,1-2H3,(H,14,15).
What are the key properties of 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole?
2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole has a molecular weight of 324.46 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-4-methylsulfanylpyrimidin-2-yl)methylsulfinyl]-1H-thieno[3,4-d]imidazole is sourced from PubChem (CID 22166947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).