About bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone
bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone (PubChem CID 22167543) has the molecular formula C21H12F10OS2
and a molecular weight of 534.44 g/mol. Its IUPAC name is bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone.
Molecular Properties
| Compound Name | bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone |
| PubChem CID | 22167543 |
| Molecular Formula | C21H12F10OS2 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone |
| SMILES | O=C(C1(SC(F)(F)F)CC1c1ccc(F)cc1F)C1(SC(F)(F)F)CC1c1ccc(F)cc1F |
| InChI | InChI=1S/C21H12F10OS2/c22-9-1-3-11(15(24)5-9)13-7-18(13,33-20(26,27)28)17(32)19(34-21(29,30)31)8-14(19)12-4-2-10(23)6-16(12)25/h1-6,13-14H,7-8H2 |
| InChIKey | RWSHSXCYVMOWDH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone?
The IUPAC name of bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone (CID 22167543) is bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone.
What is the SMILES notation for bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone?
The canonical SMILES for bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone is O=C(C1(SC(F)(F)F)CC1c1ccc(F)cc1F)C1(SC(F)(F)F)CC1c1ccc(F)cc1F.
What is the InChIKey of bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone?
The InChIKey is RWSHSXCYVMOWDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12F10OS2/c22-9-1-3-11(15(24)5-9)13-7-18(13,33-20(26,27)28)17(32)19(34-21(29,30)31)8-14(19)12-4-2-10(23)6-16(12)25/h1-6,13-14H,7-8H2.
What are the key properties of bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone?
bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone has a molecular weight of 534.44 g/mol, XLogP of 7.47, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2,4-difluorophenyl)-1-(trifluoromethylsulfanyl)cyclopropyl]methanone is sourced from PubChem (CID 22167543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).