C14H22FeN3O8 — CID 22167699
azanium;2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;iron(3+) (PubChem CID 22167699) has the molecular formula C14H22FeN3O8 and a molecular weight of 416.19 g/mol. Its IUPAC name is azanium;2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;iron(3+).
| Compound Name | azanium;2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;iron(3+) |
|---|---|
| PubChem CID | 22167699 |
| Molecular Formula | C14H22FeN3O8 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | azanium;2-[3,3-diamino-1,2,2-tris(carboxylatomethyl)cyclohexyl]acetate;iron(3+) |
| SMILES | NC1(N)CCCC(CC(=O)[O-])(CC(=O)[O-])C1(CC(=O)[O-])CC(=O)[O-].[Fe+3].[NH4+] |
| InChI | InChI=1S/C14H22N2O8.Fe.H3N/c15-14(16)3-1-2-12(4-8(17)18,5-9(19)20)13(14,6-10(21)22)7-11(23)24;;/h1-7,15-16H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24);;1H3/q;+3;/p-3 |
| InChIKey | GLWUNWFNTOBLPW-UHFFFAOYSA-K |
| XLogP | -5.31 |
| TPSA | 249.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|