About (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate
(3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate (PubChem CID 22168442) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate.
Molecular Properties
| Compound Name | (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate |
| PubChem CID | 22168442 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate |
| SMILES | CCC(C)c1cc(COC(C)=O)on1 |
| InChI | InChI=1S/C10H15NO3/c1-4-7(2)10-5-9(14-11-10)6-13-8(3)12/h5,7H,4,6H2,1-3H3 |
| InChIKey | GYIYRRFHDPWBNJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate?
The IUPAC name of (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate (CID 22168442) is (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate.
What is the SMILES notation for (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate?
The canonical SMILES for (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate is CCC(C)c1cc(COC(C)=O)on1.
What is the InChIKey of (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate?
The InChIKey is GYIYRRFHDPWBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-4-7(2)10-5-9(14-11-10)6-13-8(3)12/h5,7H,4,6H2,1-3H3.
What are the key properties of (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate?
(3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate has a molecular weight of 197.23 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butan-2-yl-1,2-oxazol-5-yl)methyl acetate is sourced from PubChem (CID 22168442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).