C24H19ClN2O3S — CID 2216871
ethyl 4-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate (PubChem CID 2216871) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is ethyl 4-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 4-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 2216871 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | ethyl 4-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nc(-c2ccccc2)cc(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C24H19ClN2O3S/c1-2-30-23(29)12-19(28)15-31-24-21(14-26)20(16-8-10-18(25)11-9-16)13-22(27-24)17-6-4-3-5-7-17/h3-11,13H,2,12,15H2,1H3 |
| InChIKey | MDYYRTUAZYWVPZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|