About 1,2-dicyclohexylimidazole
1,2-dicyclohexylimidazole (PubChem CID 22168995) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,2-dicyclohexylimidazole.
Molecular Properties
| Compound Name | 1,2-dicyclohexylimidazole |
| PubChem CID | 22168995 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1,2-dicyclohexylimidazole |
| SMILES | c1cn(C2CCCCC2)c(C2CCCCC2)n1 |
| InChI | InChI=1S/C15H24N2/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14/h11-14H,1-10H2 |
| InChIKey | MTXUFVDQHDIHJQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dicyclohexylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dicyclohexylimidazole?
The IUPAC name of 1,2-dicyclohexylimidazole (CID 22168995) is 1,2-dicyclohexylimidazole.
What is the SMILES notation for 1,2-dicyclohexylimidazole?
The canonical SMILES for 1,2-dicyclohexylimidazole is c1cn(C2CCCCC2)c(C2CCCCC2)n1.
What is the InChIKey of 1,2-dicyclohexylimidazole?
The InChIKey is MTXUFVDQHDIHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14/h11-14H,1-10H2.
What are the key properties of 1,2-dicyclohexylimidazole?
1,2-dicyclohexylimidazole has a molecular weight of 232.37 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dicyclohexylimidazole is sourced from PubChem (CID 22168995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).