About ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate
ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate (PubChem CID 22169068) has the molecular formula C18H17Cl2NO5
and a molecular weight of 398.24 g/mol. Its IUPAC name is ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate |
| PubChem CID | 22169068 |
| Molecular Formula | C18H17Cl2NO5 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate |
| SMILES | CCOC(=O)C(C)Nc1ccccc1C(=O)c1cc(Cl)c(O)c(Cl)c1O |
| InChI | InChI=1S/C18H17Cl2NO5/c1-3-26-18(25)9(2)21-13-7-5-4-6-10(13)15(22)11-8-12(19)17(24)14(20)16(11)23/h4-9,21,23-24H,3H2,1-2H3 |
| InChIKey | CNPZBHCEBRLDDJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate?
The IUPAC name of ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate (CID 22169068) is ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate.
What is the SMILES notation for ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate?
The canonical SMILES for ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate is CCOC(=O)C(C)Nc1ccccc1C(=O)c1cc(Cl)c(O)c(Cl)c1O.
What is the InChIKey of ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate?
The InChIKey is CNPZBHCEBRLDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO5/c1-3-26-18(25)9(2)21-13-7-5-4-6-10(13)15(22)11-8-12(19)17(24)14(20)16(11)23/h4-9,21,23-24H,3H2,1-2H3.
What are the key properties of ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate?
ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate has a molecular weight of 398.24 g/mol, XLogP of 4.00, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(3,5-dichloro-2,4-dihydroxybenzoyl)anilino]propanoate is sourced from PubChem (CID 22169068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).