C7H8F9NO2S — CID 22169334
1,1,2,2,3,3,4,4,4-nonafluoro-N-propylbutane-1-sulfonamide (PubChem CID 22169334) has the molecular formula C7H8F9NO2S and a molecular weight of 341.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-propylbutane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-propylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 22169334 |
| Molecular Formula | C7H8F9NO2S |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-propylbutane-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F9NO2S/c1-2-3-17-20(18,19)7(15,16)5(10,11)4(8,9)6(12,13)14/h17H,2-3H2,1H3 |
| InChIKey | CCCYGFBNAZKKTO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|