C14H9F3N4O4 — CID 2216997
N-[(3R,4S)-4-cyano-5-methylidene-2-oxo-3-(trifluoromethyl)pyrrolidin-3-yl]-3-nitrobenzamide (PubChem CID 2216997) has the molecular formula C14H9F3N4O4 and a molecular weight of 354.24 g/mol. Its IUPAC name is N-[(3R,4S)-4-cyano-5-methylidene-2-oxo-3-(trifluoromethyl)pyrrolidin-3-yl]-3-nitrobenzamide.
| Compound Name | N-[(3R,4S)-4-cyano-5-methylidene-2-oxo-3-(trifluoromethyl)pyrrolidin-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2216997 |
| Molecular Formula | C14H9F3N4O4 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[(3R,4S)-4-cyano-5-methylidene-2-oxo-3-(trifluoromethyl)pyrrolidin-3-yl]-3-nitrobenzamide |
| SMILES | C=C1NC(=O)[C@@](NC(=O)c2cccc([N+](=O)[O-])c2)(C(F)(F)F)[C@H]1C#N |
| InChI | InChI=1S/C14H9F3N4O4/c1-7-10(6-18)13(12(23)19-7,14(15,16)17)20-11(22)8-3-2-4-9(5-8)21(24)25/h2-5,10H,1H2,(H,19,23)(H,20,22)/t10-,13+/m0/s1 |
| InChIKey | ZKOQPFKATYZONR-GXFFZTMASA-N |
| XLogP | 1.41 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|