C25H35N5O4 — CID 22170027
2-[[2-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-6-butylpyrimidin-4-yl]amino]-4-methylpentanoic acid (PubChem CID 22170027) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[[2-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-6-butylpyrimidin-4-yl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-6-butylpyrimidin-4-yl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22170027 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[[2-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-6-butylpyrimidin-4-yl]amino]-4-methylpentanoic acid |
| SMILES | CCCCc1cc(NC(CC(C)C)C(=O)O)nc(N2CCN(c3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C25H35N5O4/c1-4-5-6-18-14-23(27-20(24(31)32)13-17(2)3)28-25(26-18)30-11-9-29(10-12-30)19-7-8-21-22(15-19)34-16-33-21/h7-8,14-15,17,20H,4-6,9-13,16H2,1-3H3,(H,31,32)(H,26,27,28) |
| InChIKey | UIAMDDJVVUBOPT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|