About 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid
3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid (PubChem CID 22170126) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid |
| PubChem CID | 22170126 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid |
| SMILES | O=C(O)C1=CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C7H9NO4/c9-6(10)5-2-1-3-8(4-5)7(11)12/h2H,1,3-4H2,(H,9,10)(H,11,12) |
| InChIKey | WVHFXWNAYHOFON-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
The IUPAC name of 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid (CID 22170126) is 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid.
What is the SMILES notation for 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
The canonical SMILES for 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid is O=C(O)C1=CCCN(C(=O)O)C1.
What is the InChIKey of 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
The InChIKey is WVHFXWNAYHOFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c9-6(10)5-2-1-3-8(4-5)7(11)12/h2H,1,3-4H2,(H,9,10)(H,11,12).
What are the key properties of 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid?
3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid has a molecular weight of 171.15 g/mol, XLogP of 0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-2H-pyridine-1,5-dicarboxylic acid is sourced from PubChem (CID 22170126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).