C18H16ClN3O3 — CID 22170205
4-(3-chloroanilino)-6,7-dimethoxyquinoline-3-carboxamide (PubChem CID 22170205) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 4-(3-chloroanilino)-6,7-dimethoxyquinoline-3-carboxamide.
| Compound Name | 4-(3-chloroanilino)-6,7-dimethoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22170205 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-(3-chloroanilino)-6,7-dimethoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cccc(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C18H16ClN3O3/c1-24-15-7-12-14(8-16(15)25-2)21-9-13(18(20)23)17(12)22-11-5-3-4-10(19)6-11/h3-9H,1-2H3,(H2,20,23)(H,21,22) |
| InChIKey | PDHPVHXEKOECNM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |