C24H30N4O4 — CID 22170229
7-methoxy-4-(3-methoxy-2-methylanilino)-6-[2-(propan-2-ylamino)ethoxy]quinoline-3-carboxamide (PubChem CID 22170229) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 7-methoxy-4-(3-methoxy-2-methylanilino)-6-[2-(propan-2-ylamino)ethoxy]quinoline-3-carboxamide.
| Compound Name | 7-methoxy-4-(3-methoxy-2-methylanilino)-6-[2-(propan-2-ylamino)ethoxy]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 22170229 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 7-methoxy-4-(3-methoxy-2-methylanilino)-6-[2-(propan-2-ylamino)ethoxy]quinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cccc(OC)c3C)c2cc1OCCNC(C)C |
| InChI | InChI=1S/C24H30N4O4/c1-14(2)26-9-10-32-22-11-16-19(12-21(22)31-5)27-13-17(24(25)29)23(16)28-18-7-6-8-20(30-4)15(18)3/h6-8,11-14,26H,9-10H2,1-5H3,(H2,25,29)(H,27,28) |
| InChIKey | FKXURLRIZHPHTP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|