About 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid
3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid (PubChem CID 22170278) has the molecular formula C20H19N3O5
and a molecular weight of 381.39 g/mol. Its IUPAC name is 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid |
| PubChem CID | 22170278 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cccc(C(=O)O)c3C)c2cc1OC |
| InChI | InChI=1S/C20H19N3O5/c1-10-11(20(25)26)5-4-6-14(10)23-18-12-7-16(27-2)17(28-3)8-15(12)22-9-13(18)19(21)24/h4-9H,1-3H3,(H2,21,24)(H,22,23)(H,25,26) |
| InChIKey | IRQKVVCDXXXGGC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid?
The IUPAC name of 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid (CID 22170278) is 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid.
What is the SMILES notation for 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid?
The canonical SMILES for 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid is COc1cc2ncc(C(N)=O)c(Nc3cccc(C(=O)O)c3C)c2cc1OC.
What is the InChIKey of 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid?
The InChIKey is IRQKVVCDXXXGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O5/c1-10-11(20(25)26)5-4-6-14(10)23-18-12-7-16(27-2)17(28-3)8-15(12)22-9-13(18)19(21)24/h4-9H,1-3H3,(H2,21,24)(H,22,23)(H,25,26).
What are the key properties of 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid?
3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid has a molecular weight of 381.39 g/mol, XLogP of 3.10, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-carbamoyl-6,7-dimethoxyquinolin-4-yl)amino]-2-methylbenzoic acid is sourced from PubChem (CID 22170278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).