C25H28N6O3S2 — CID 22170398
N-[5-[3-(4-acetylpiperazine-1-carbonyl)-4-aminophenyl]sulfanyl-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide (PubChem CID 22170398) has the molecular formula C25H28N6O3S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is N-[5-[3-(4-acetylpiperazine-1-carbonyl)-4-aminophenyl]sulfanyl-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[5-[3-(4-acetylpiperazine-1-carbonyl)-4-aminophenyl]sulfanyl-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 22170398 |
| Molecular Formula | C25H28N6O3S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | N-[5-[3-(4-acetylpiperazine-1-carbonyl)-4-aminophenyl]sulfanyl-1,3-thiazol-2-yl]-4-(dimethylamino)benzamide |
| SMILES | CC(=O)N1CCN(C(=O)c2cc(Sc3cnc(NC(=O)c4ccc(N(C)C)cc4)s3)ccc2N)CC1 |
| InChI | InChI=1S/C25H28N6O3S2/c1-16(32)30-10-12-31(13-11-30)24(34)20-14-19(8-9-21(20)26)35-22-15-27-25(36-22)28-23(33)17-4-6-18(7-5-17)29(2)3/h4-9,14-15H,10-13,26H2,1-3H3,(H,27,28,33) |
| InChIKey | WPPDGWMXKWIRFC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|