About 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole
3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole (PubChem CID 22170949) has the molecular formula C13H10F6N2S
and a molecular weight of 340.29 g/mol. Its IUPAC name is 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole |
| PubChem CID | 22170949 |
| Molecular Formula | C13H10F6N2S |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1ccc(C2(C(F)(F)F)C=CN=N2)cc1SCC(F)(F)F |
| InChI | InChI=1S/C13H10F6N2S/c1-8-2-3-9(6-10(8)22-7-12(14,15)16)11(13(17,18)19)4-5-20-21-11/h2-6H,7H2,1H3 |
| InChIKey | JOUJYWWGGHNRCL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole?
The IUPAC name of 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole (CID 22170949) is 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole.
What is the SMILES notation for 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole?
The canonical SMILES for 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole is Cc1ccc(C2(C(F)(F)F)C=CN=N2)cc1SCC(F)(F)F.
What is the InChIKey of 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole?
The InChIKey is JOUJYWWGGHNRCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F6N2S/c1-8-2-3-9(6-10(8)22-7-12(14,15)16)11(13(17,18)19)4-5-20-21-11/h2-6H,7H2,1H3.
What are the key properties of 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole?
3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole has a molecular weight of 340.29 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-methyl-3-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(trifluoromethyl)pyrazole is sourced from PubChem (CID 22170949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).