C17H22BrN3O3 — CID 2217143
(5R)-3-(3-bromophenyl)-N-(3-morpholin-4-ylpropyl)-2,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 2217143) has the molecular formula C17H22BrN3O3 and a molecular weight of 396.29 g/mol. Its IUPAC name is (5R)-3-(3-bromophenyl)-N-(3-morpholin-4-ylpropyl)-2,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (5R)-3-(3-bromophenyl)-N-(3-morpholin-4-ylpropyl)-2,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 2217143 |
| Molecular Formula | C17H22BrN3O3 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (5R)-3-(3-bromophenyl)-N-(3-morpholin-4-ylpropyl)-2,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)[C@H]1C=C(c2cccc(Br)c2)NO1 |
| InChI | InChI=1S/C17H22BrN3O3/c18-14-4-1-3-13(11-14)15-12-16(24-20-15)17(22)19-5-2-6-21-7-9-23-10-8-21/h1,3-4,11-12,16,20H,2,5-10H2,(H,19,22)/t16-/m1/s1 |
| InChIKey | QQQYIRGCHIXSKO-MRXNPFEDSA-N |
| XLogP | 1.53 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|