2-methylidene-5-methylsulfanylpentanoic acid

C7H12O2S — CID 22171726

IUPAC2-methylidene-5-methylsulfanylpentanoic acid
SMILESC=C(CCCSC)C(=O)O
InChIInChI=1S/C7H12O2S/c1-6(7(8)9)4-3-5-10-2/h1,3-5H2,2H3,(H,8,9)
InChIKeyMQWWRFYOVIOPQY-UHFFFAOYSA-N
MW160.24 g/mol
LogP1.77
Rot. Bonds5

About 2-methylidene-5-methylsulfanylpentanoic acid

2-methylidene-5-methylsulfanylpentanoic acid (PubChem CID 22171726) has the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-methylidene-5-methylsulfanylpentanoic acid.

Molecular Properties

Compound Name2-methylidene-5-methylsulfanylpentanoic acid
PubChem CID22171726
Molecular FormulaC7H12O2S
Molecular Weight160.24 g/mol
Exact Mass160.06
IUPAC Name2-methylidene-5-methylsulfanylpentanoic acid
SMILESC=C(CCCSC)C(=O)O
InChIInChI=1S/C7H12O2S/c1-6(7(8)9)4-3-5-10-2/h1,3-5H2,2H3,(H,8,9)
InChIKeyMQWWRFYOVIOPQY-UHFFFAOYSA-N
XLogP1.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.24
LogP ≤ 51.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methylidene-5-methylsulfanylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylidene-5-methylsulfanylpentanoic acid?
The IUPAC name of 2-methylidene-5-methylsulfanylpentanoic acid (CID 22171726) is 2-methylidene-5-methylsulfanylpentanoic acid.
What is the SMILES notation for 2-methylidene-5-methylsulfanylpentanoic acid?
The canonical SMILES for 2-methylidene-5-methylsulfanylpentanoic acid is C=C(CCCSC)C(=O)O.
What is the InChIKey of 2-methylidene-5-methylsulfanylpentanoic acid?
The InChIKey is MQWWRFYOVIOPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S/c1-6(7(8)9)4-3-5-10-2/h1,3-5H2,2H3,(H,8,9).
What are the key properties of 2-methylidene-5-methylsulfanylpentanoic acid?
2-methylidene-5-methylsulfanylpentanoic acid has a molecular weight of 160.24 g/mol, XLogP of 1.77, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-5-methylsulfanylpentanoic acid is sourced from PubChem (CID 22171726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).