C17H11F3N4O2S — CID 2217204
(5R)-5-(1,3-benzothiazol-2-ylamino)-3-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 2217204) has the molecular formula C17H11F3N4O2S and a molecular weight of 392.36 g/mol. Its IUPAC name is (5R)-5-(1,3-benzothiazol-2-ylamino)-3-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(1,3-benzothiazol-2-ylamino)-3-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2217204 |
| Molecular Formula | C17H11F3N4O2S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | (5R)-5-(1,3-benzothiazol-2-ylamino)-3-phenyl-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@](Nc2nc3ccccc3s2)(C(F)(F)F)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H11F3N4O2S/c18-17(19,20)16(22-14-21-11-8-4-5-9-12(11)27-14)13(25)24(15(26)23-16)10-6-2-1-3-7-10/h1-9H,(H,21,22)(H,23,26)/t16-/m0/s1 |
| InChIKey | GDZZMRRQBRFZGM-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|