About 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene
3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 22172249) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene.
Molecular Properties
| Compound Name | 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene |
| PubChem CID | 22172249 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C=Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C10H10/c1-2-8-3-4-9-5-6-10(9)7-8/h2-4,7H,1,5-6H2 |
| InChIKey | DTGDMPJDZKDHEP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene?
The IUPAC name of 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene (CID 22172249) is 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene.
What is the SMILES notation for 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene?
The canonical SMILES for 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene is C=Cc1ccc2c(c1)CC2.
What is the InChIKey of 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene?
The InChIKey is DTGDMPJDZKDHEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-2-8-3-4-9-5-6-10(9)7-8/h2-4,7H,1,5-6H2.
What are the key properties of 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene?
3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene has a molecular weight of 130.19 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene is sourced from PubChem (CID 22172249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).