About 4,5-dihydroxypentanal
4,5-dihydroxypentanal (PubChem CID 22172474) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is 4,5-dihydroxypentanal.
Molecular Properties
| Compound Name | 4,5-dihydroxypentanal |
| PubChem CID | 22172474 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | 4,5-dihydroxypentanal |
| SMILES | O=CCCC(O)CO |
| InChI | InChI=1S/C5H10O3/c6-3-1-2-5(8)4-7/h3,5,7-8H,1-2,4H2 |
| InChIKey | LFRDGHVRPSURMV-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxypentanal?
The IUPAC name of 4,5-dihydroxypentanal (CID 22172474) is 4,5-dihydroxypentanal.
What is the SMILES notation for 4,5-dihydroxypentanal?
The canonical SMILES for 4,5-dihydroxypentanal is O=CCCC(O)CO.
What is the InChIKey of 4,5-dihydroxypentanal?
The InChIKey is LFRDGHVRPSURMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3/c6-3-1-2-5(8)4-7/h3,5,7-8H,1-2,4H2.
What are the key properties of 4,5-dihydroxypentanal?
4,5-dihydroxypentanal has a molecular weight of 118.13 g/mol, XLogP of -0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxypentanal is sourced from PubChem (CID 22172474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).