About N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride
N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride (PubChem CID 22172665) has the molecular formula C19H21ClN4O2
and a molecular weight of 372.86 g/mol. Its IUPAC name is N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride |
| PubChem CID | 22172665 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride |
| SMILES | CCOCC(=O)Nc1cnc2cccnc2c1NCc1ccccc1.Cl |
| InChI | InChI=1S/C19H20N4O2.ClH/c1-2-25-13-17(24)23-16-12-21-15-9-6-10-20-18(15)19(16)22-11-14-7-4-3-5-8-14;/h3-10,12H,2,11,13H2,1H3,(H,21,22)(H,23,24);1H |
| InChIKey | QJZFCQPRSYMNCQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride?
The IUPAC name of N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride (CID 22172665) is N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride.
What is the SMILES notation for N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride?
The canonical SMILES for N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride is CCOCC(=O)Nc1cnc2cccnc2c1NCc1ccccc1.Cl.
What is the InChIKey of N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride?
The InChIKey is QJZFCQPRSYMNCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2.ClH/c1-2-25-13-17(24)23-16-12-21-15-9-6-10-20-18(15)19(16)22-11-14-7-4-3-5-8-14;/h3-10,12H,2,11,13H2,1H3,(H,21,22)(H,23,24);1H.
What are the key properties of N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride?
N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride has a molecular weight of 372.86 g/mol, XLogP of 3.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(benzylamino)-1,5-naphthyridin-3-yl]-2-ethoxyacetamide;hydrochloride is sourced from PubChem (CID 22172665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).