C7H7F8NO — CID 22172824
2,2,3,3,5,5,6,6-octafluoro-4-propan-2-ylmorpholine (PubChem CID 22172824) has the molecular formula C7H7F8NO and a molecular weight of 273.12 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-propan-2-ylmorpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 22172824 |
| Molecular Formula | C7H7F8NO |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C7H7F8NO/c1-3(2)16-4(8,9)6(12,13)17-7(14,15)5(16,10)11/h3H,1-2H3 |
| InChIKey | VNQDQRACRQOKOW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|