C10H8Cl2O — CID 22173116
6,7-dichloro-2-methyl-2,3-dihydroinden-1-one (PubChem CID 22173116) has the molecular formula C10H8Cl2O and a molecular weight of 215.08 g/mol. Its IUPAC name is 6,7-dichloro-2-methyl-2,3-dihydroinden-1-one.
| Compound Name | 6,7-dichloro-2-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 22173116 |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 6,7-dichloro-2-methyl-2,3-dihydroinden-1-one |
| SMILES | CC1Cc2ccc(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C10H8Cl2O/c1-5-4-6-2-3-7(11)9(12)8(6)10(5)13/h2-3,5H,4H2,1H3 |
| InChIKey | ZRUMTPPMBRXVPA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |